C14H22N5O15P3 — CID 87347038
2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl acetate (PubChem CID 87347038) has the molecular formula C14H22N5O15P3 and a molecular weight of 593.27 g/mol. Its IUPAC name is 2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl acetate.
| Compound Name | 2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl acetate |
|---|---|
| PubChem CID | 87347038 |
| Molecular Formula | C14H22N5O15P3 |
| Molecular Weight | 593.27 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | 2-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxyethyl acetate |
| SMILES | CC(=O)OCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22N5O15P3/c1-7(20)29-2-3-30-35(23,24)33-37(27,28)34-36(25,26)31-4-8-10(21)11(22)14(32-8)19-6-18-9-12(15)16-5-17-13(9)19/h5-6,8,10-11,14,21-22H,2-4H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H2,15,16,17)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | STFYNQKDYLNXJJ-IDTAVKCVSA-N |
| XLogP | -1.04 |
| TPSA | 294.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|