C15H26N5O13P3 — CID 71507522
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(pentoxy)phosphoryl] hydrogen phosphate (PubChem CID 71507522) has the molecular formula C15H26N5O13P3 and a molecular weight of 577.32 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(pentoxy)phosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(pentoxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 71507522 |
| Molecular Formula | C15H26N5O13P3 |
| Molecular Weight | 577.32 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(pentoxy)phosphoryl] hydrogen phosphate |
| SMILES | CCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26N5O13P3/c1-2-3-4-5-29-34(23,24)32-36(27,28)33-35(25,26)30-6-9-11(21)12(22)15(31-9)20-8-19-10-13(16)17-7-18-14(10)20/h7-9,11-12,15,21-22H,2-6H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H2,16,17,18)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | SUQZSZIZAZFXPJ-SDBHATRESA-N |
| XLogP | 0.59 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|