C15H18N5O7P — CID 23656772
[(3aR,4R,6R,6aR)-4-(6-amino-2-ethynylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 23656772) has the molecular formula C15H18N5O7P and a molecular weight of 411.31 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-amino-2-ethynylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-amino-2-ethynylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 23656772 |
| Molecular Formula | C15H18N5O7P |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-amino-2-ethynylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | C#Cc1nc(N)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C15H18N5O7P/c1-4-8-18-12(16)9-13(19-8)20(6-17-9)14-11-10(26-15(2,3)27-11)7(25-14)5-24-28(21,22)23/h1,6-7,10-11,14H,5H2,2-3H3,(H2,16,18,19)(H2,21,22,23)/t7-,10-,11-,14-/m1/s1 |
| InChIKey | KYTSSBHPLVSCHC-FRJWGUMJSA-N |
| XLogP | -0.08 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|