C15H16N6O4 — CID 58178622
9-[(3aR,4R,6S,6aS)-6-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-2-carbonitrile (PubChem CID 58178622) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 9-[(3aR,4R,6S,6aS)-6-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-2-carbonitrile.
| Compound Name | 9-[(3aR,4R,6S,6aS)-6-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-2-carbonitrile |
|---|---|
| PubChem CID | 58178622 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 9-[(3aR,4R,6S,6aS)-6-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-2-carbonitrile |
| SMILES | CC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#N)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H16N6O4/c1-6(22)9-10-11(25-15(2,3)24-10)14(23-9)21-5-18-8-12(17)19-7(4-16)20-13(8)21/h5,9-11,14H,1-3H3,(H2,17,19,20)/t9-,10-,11-,14-/m1/s1 |
| InChIKey | GXPQVIFXSQPMEY-ZHSDAYTOSA-N |
| XLogP | 0.29 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |