C14H16ClN5O5 — CID 54214244
1-[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-chloro-2-hydroxyethanone (PubChem CID 54214244) has the molecular formula C14H16ClN5O5 and a molecular weight of 369.77 g/mol. Its IUPAC name is 1-[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-chloro-2-hydroxyethanone.
| Compound Name | 1-[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-chloro-2-hydroxyethanone |
|---|---|
| PubChem CID | 54214244 |
| Molecular Formula | C14H16ClN5O5 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-chloro-2-hydroxyethanone |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)C(O)Cl)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H16ClN5O5/c1-14(2)24-8-7(6(21)10(15)22)23-13(9(8)25-14)20-4-19-5-11(16)17-3-18-12(5)20/h3-4,7-10,13,22H,1-2H3,(H2,16,17,18)/t7-,8-,9-,10?,13-/m1/s1 |
| InChIKey | PYAKKHBKVJTMNS-IZARQFCQSA-N |
| XLogP | -0.05 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|