C14H18N6O5 — CID 10641578
(2R)-2-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetamide (PubChem CID 10641578) has the molecular formula C14H18N6O5 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2R)-2-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetamide.
| Compound Name | (2R)-2-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 10641578 |
| Molecular Formula | C14H18N6O5 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2R)-2-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyacetamide |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@H](n1cnc3c(N)ncnc31)O[C@@H]2[C@@H](O)C(N)=O |
| InChI | InChI=1S/C14H18N6O5/c1-14(2)24-8-7(6(21)11(16)22)23-13(9(8)25-14)20-4-19-5-10(15)17-3-18-12(5)20/h3-4,6-9,13,21H,1-2H3,(H2,16,22)(H2,15,17,18)/t6-,7-,8-,9-,13-/m1/s1 |
| InChIKey | DAIPJSARWQRKLC-PCQLPTCXSA-N |
| XLogP | -1.33 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |