C15H19FN6O4 — CID 10713923
(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-(2-fluoroethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 10713923) has the molecular formula C15H19FN6O4 and a molecular weight of 366.35 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-(2-fluoroethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-(2-fluoroethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 10713923 |
| Molecular Formula | C15H19FN6O4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-(2-fluoroethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)NCCF)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H19FN6O4/c1-15(2)25-8-9(13(23)18-4-3-16)24-14(10(8)26-15)22-6-21-7-11(17)19-5-20-12(7)22/h5-6,8-10,14H,3-4H2,1-2H3,(H,18,23)(H2,17,19,20)/t8-,9+,10-,14-/m1/s1 |
| InChIKey | HHBOZEMJCUCRPF-QOBXEIRBSA-N |
| XLogP | -0.09 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |