C20H26N6O4 — CID 10835603
(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 10835603) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 10835603 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)NC1C[C@@H]3CC[C@H]1C3)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H26N6O4/c1-20(2)29-13-14(18(27)25-11-6-9-3-4-10(11)5-9)28-19(15(13)30-20)26-8-24-12-16(21)22-7-23-17(12)26/h7-11,13-15,19H,3-6H2,1-2H3,(H,25,27)(H2,21,22,23)/t9-,10+,11?,13-,14+,15-,19-/m1/s1 |
| InChIKey | UEFZILCMWTXOOP-VVXDBSHOSA-N |
| XLogP | 1.13 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |