C23H21FN8O4 — CID 138580244
(3aR,6S,6aS)-4-(6-aminopurin-9-yl)-N-[4-(6-cyano-5-fluoro-2-pyridinyl)but-3-ynyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 138580244) has the molecular formula C23H21FN8O4 and a molecular weight of 492.47 g/mol. Its IUPAC name is (3aR,6S,6aS)-4-(6-aminopurin-9-yl)-N-[4-(6-cyano-5-fluoro-2-pyridinyl)but-3-ynyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,6S,6aS)-4-(6-aminopurin-9-yl)-N-[4-(6-cyano-5-fluoro-2-pyridinyl)but-3-ynyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 138580244 |
| Molecular Formula | C23H21FN8O4 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (3aR,6S,6aS)-4-(6-aminopurin-9-yl)-N-[4-(6-cyano-5-fluoro-2-pyridinyl)but-3-ynyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](C(=O)NCCC#Cc3ccc(F)c(C#N)n3)OC(n3cnc4c(N)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C23H21FN8O4/c1-23(2)35-16-17(21(33)27-8-4-3-5-12-6-7-13(24)14(9-25)31-12)34-22(18(16)36-23)32-11-30-15-19(26)28-10-29-20(15)32/h6-7,10-11,16-18,22H,4,8H2,1-2H3,(H,27,33)(H2,26,28,29)/t16-,17+,18-,22?/m1/s1 |
| InChIKey | JPYXCYJXMCBHES-XVSHDKDLSA-N |
| XLogP | 0.79 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|