C17H21N7O4 — CID 58085632
(3aR,4R,6S,6aS)-4-[2-cyano-6-(ethylamino)purin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 58085632) has the molecular formula C17H21N7O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-[2-cyano-6-(ethylamino)purin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-4-[2-cyano-6-(ethylamino)purin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 58085632 |
| Molecular Formula | C17H21N7O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-[2-cyano-6-(ethylamino)purin-9-yl]-N,2,2-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CCNc1nc(C#N)nc2c1ncn2[C@@H]1O[C@H](C(=O)NC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H21N7O4/c1-5-20-13-9-14(23-8(6-18)22-13)24(7-21-9)16-12-10(27-17(2,3)28-12)11(26-16)15(25)19-4/h7,10-12,16H,5H2,1-4H3,(H,19,25)(H,20,22,23)/t10-,11+,12-,16-/m1/s1 |
| InChIKey | CEAJUXGGZSTNQF-AZKPJATDSA-N |
| XLogP | 0.29 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |