C22H22N6O5 — CID 89211975
(4R,6S,6aR)-4-[6-[(4-methoxyphenyl)methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl cyanide (PubChem CID 89211975) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is (4R,6S,6aR)-4-[6-[(4-methoxyphenyl)methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl cyanide.
| Compound Name | (4R,6S,6aR)-4-[6-[(4-methoxyphenyl)methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl cyanide |
|---|---|
| PubChem CID | 89211975 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (4R,6S,6aR)-4-[6-[(4-methoxyphenyl)methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl cyanide |
| SMILES | COc1ccc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)C#N)[C@@H]3OC(C)(C)OC32)cc1 |
| InChI | InChI=1S/C22H22N6O5/c1-22(2)32-17-16(14(29)8-23)31-21(18(17)33-22)28-11-27-15-19(25-10-26-20(15)28)24-9-12-4-6-13(30-3)7-5-12/h4-7,10-11,16-18,21H,9H2,1-3H3,(H,24,25,26)/t16-,17+,18?,21-/m1/s1 |
| InChIKey | BMLXBOLIGKGXLH-PGGWPXBNSA-N |
| XLogP | 1.96 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|