C22H27N5O4 — CID 71037287
9-[(4R,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)methyl]purin-6-amine (PubChem CID 71037287) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 9-[(4R,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | 9-[(4R,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 71037287 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 9-[(4R,6R,6aS)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)methyl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(OC)cc4)ncnc32)C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H27N5O4/c1-5-15-17-18(31-22(2,3)30-17)21(29-15)27-12-26-16-19(24-11-25-20(16)27)23-10-13-6-8-14(28-4)9-7-13/h6-9,11-12,15,17-18,21H,5,10H2,1-4H3,(H,23,24,25)/t15-,17+,18?,21-/m1/s1 |
| InChIKey | ZCWDIACTRQQPNM-YQQPOAOISA-N |
| XLogP | 3.27 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |