C15H21N5O3 — CID 20669899
9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-N-methylpurin-6-amine (PubChem CID 20669899) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-N-methylpurin-6-amine.
| Compound Name | 9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 20669899 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 9-(6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-N-methylpurin-6-amine |
| SMILES | CCC1OC(n2cnc3c(NC)ncnc32)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C15H21N5O3/c1-5-8-10-11(23-15(2,3)22-10)14(21-8)20-7-19-9-12(16-4)17-6-18-13(9)20/h6-8,10-11,14H,5H2,1-4H3,(H,16,17,18) |
| InChIKey | OAVSDOBTJKEBMD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |