C14H18N8O3 — CID 20669897
9-[6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-methylpurin-6-amine (PubChem CID 20669897) has the molecular formula C14H18N8O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 9-[6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-methylpurin-6-amine.
| Compound Name | 9-[6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 20669897 |
| Molecular Formula | C14H18N8O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 9-[6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-methylpurin-6-amine |
| SMILES | CNc1ncnc2c1ncn2C1OC(CN=[N+]=[N-])C2OC(C)(C)OC21 |
| InChI | InChI=1S/C14H18N8O3/c1-14(2)24-9-7(4-20-21-15)23-13(10(9)25-14)22-6-19-8-11(16-3)17-5-18-12(8)22/h5-7,9-10,13H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | FLSFMLMIQBUCHW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|