C20H20N8O4 — CID 153308261
N-[9-[(4R,6R,6aS)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide (PubChem CID 153308261) has the molecular formula C20H20N8O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[9-[(4R,6R,6aS)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(4R,6R,6aS)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 153308261 |
| Molecular Formula | C20H20N8O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[9-[(4R,6R,6aS)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](CN=[N+]=[N-])O[C@H]2n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C20H20N8O4/c1-20(2)31-14-12(8-25-27-21)30-19(15(14)32-20)28-10-24-13-16(22-9-23-17(13)28)26-18(29)11-6-4-3-5-7-11/h3-7,9-10,12,14-15,19H,8H2,1-2H3,(H,22,23,26,29)/t12-,14+,15?,19-/m1/s1 |
| InChIKey | KHIBXAXSWIUUTF-SJAHPIGISA-N |
| XLogP | 2.81 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|