C26H31N7O4 — CID 130418827
N-[9-[(3aR,4R,6R,6aR)-6-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide (PubChem CID 130418827) has the molecular formula C26H31N7O4 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-[9-[(3aR,4R,6R,6aR)-6-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3aR,4R,6R,6aR)-6-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 130418827 |
| Molecular Formula | C26H31N7O4 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[9-[(3aR,4R,6R,6aR)-6-(1,7-diazaspiro[3.4]octan-1-ylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CN1CCC13CCNC3)O[C@H]2n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H31N7O4/c1-25(2)36-19-17(12-32-11-9-26(32)8-10-27-13-26)35-24(20(19)37-25)33-15-30-18-21(28-14-29-22(18)33)31-23(34)16-6-4-3-5-7-16/h3-7,14-15,17,19-20,24,27H,8-13H2,1-2H3,(H,28,29,31,34)/t17-,19-,20-,24-,26?/m1/s1 |
| InChIKey | YDQRWBIGBVHDBR-VLWTZPBGSA-N |
| XLogP | 1.93 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |