C27H37N7O4 — CID 145365193
N-[9-[5-(2,5-diazaspiro[3.5]nonan-5-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide;propane-2,2-diol (PubChem CID 145365193) has the molecular formula C27H37N7O4 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[9-[5-(2,5-diazaspiro[3.5]nonan-5-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide;propane-2,2-diol.
| Compound Name | N-[9-[5-(2,5-diazaspiro[3.5]nonan-5-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide;propane-2,2-diol |
|---|---|
| PubChem CID | 145365193 |
| Molecular Formula | C27H37N7O4 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | N-[9-[5-(2,5-diazaspiro[3.5]nonan-5-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide;propane-2,2-diol |
| SMILES | CC(C)(O)O.O=C(Nc1ncnc2c1ncn2C1CCC(CN2CCCCC23CNC3)O1)c1ccccc1 |
| InChI | InChI=1S/C24H29N7O2.C3H8O2/c32-23(17-6-2-1-3-7-17)29-21-20-22(27-15-26-21)31(16-28-20)19-9-8-18(33-19)12-30-11-5-4-10-24(30)13-25-14-24;1-3(2,4)5/h1-3,6-7,15-16,18-19,25H,4-5,8-14H2,(H,26,27,29,32);4-5H,1-2H3 |
| InChIKey | GKKACYWIFJUUPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|