C30H41N7O6 — CID 145365006
tert-butyl 1-[[5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-1,6-diazaspiro[3.3]heptane-6-carboxylate;propane-2,2-diol (PubChem CID 145365006) has the molecular formula C30H41N7O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is tert-butyl 1-[[5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-1,6-diazaspiro[3.3]heptane-6-carboxylate;propane-2,2-diol.
| Compound Name | tert-butyl 1-[[5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-1,6-diazaspiro[3.3]heptane-6-carboxylate;propane-2,2-diol |
|---|---|
| PubChem CID | 145365006 |
| Molecular Formula | C30H41N7O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | tert-butyl 1-[[5-(6-benzamidopurin-9-yl)oxolan-2-yl]methyl]-1,6-diazaspiro[3.3]heptane-6-carboxylate;propane-2,2-diol |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN2CC2CCC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)O2)C1.CC(C)(O)O |
| InChI | InChI=1S/C27H33N7O4.C3H8O2/c1-26(2,3)38-25(36)32-14-27(15-32)11-12-33(27)13-19-9-10-20(37-19)34-17-30-21-22(28-16-29-23(21)34)31-24(35)18-7-5-4-6-8-18;1-3(2,4)5/h4-8,16-17,19-20H,9-15H2,1-3H3,(H,28,29,31,35);4-5H,1-2H3 |
| InChIKey | AFPPNENVBZIATF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|