C24H21N5O5 — CID 15576398
[(2R,3R,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 15576398) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 15576398 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [(2R,3R,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@H]1C[C@@H](OC(=O)c2ccccc2)[C@@H](CO)O1)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O5/c30-12-18-17(34-24(32)16-9-5-2-6-10-16)11-19(33-18)29-14-27-20-21(25-13-26-22(20)29)28-23(31)15-7-3-1-4-8-15/h1-10,13-14,17-19,30H,11-12H2,(H,25,26,28,31)/t17-,18-,19-/m1/s1 |
| InChIKey | GRASBJRYLQJMMU-GUDVDZBRSA-N |
| XLogP | 2.58 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |