C17H17N5O4 — CID 57205627
[(2R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 57205627) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 57205627 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC(OC(=O)c2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C17H17N5O4/c18-15-14-16(20-8-19-15)22(9-21-14)13-6-11(12(7-23)25-13)26-17(24)10-4-2-1-3-5-10/h1-5,8-9,11-13,23H,6-7H2,(H2,18,19,20)/t11?,12-,13-/m1/s1 |
| InChIKey | ALGXLPTVRQAONR-VFRRUGBOSA-N |
| XLogP | 0.91 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |