C18H19N7O4 — CID 10572883
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] N-[(E)-benzylideneamino]carbamate (PubChem CID 10572883) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] N-[(E)-benzylideneamino]carbamate.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] N-[(E)-benzylideneamino]carbamate |
|---|---|
| PubChem CID | 10572883 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] N-[(E)-benzylideneamino]carbamate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](OC(=O)N/N=C/c2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C18H19N7O4/c19-16-15-17(21-9-20-16)25(10-22-15)14-6-12(13(8-26)28-14)29-18(27)24-23-7-11-4-2-1-3-5-11/h1-5,7,9-10,12-14,26H,6,8H2,(H,24,27)(H2,19,20,21)/b23-7+/t12-,13+,14+/m0/s1 |
| InChIKey | CWTVELQDGYQUNA-MGBUPKDBSA-N |
| XLogP | 0.82 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|