C10H14N5O4PS2 — CID 85146722
[5-(6-aminopurin-9-yl)-3-[hydroxy(sulfanyl)phosphinothioyl]oxyoxolan-2-yl]methanol (PubChem CID 85146722) has the molecular formula C10H14N5O4PS2 and a molecular weight of 363.36 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-[hydroxy(sulfanyl)phosphinothioyl]oxyoxolan-2-yl]methanol.
| Compound Name | [5-(6-aminopurin-9-yl)-3-[hydroxy(sulfanyl)phosphinothioyl]oxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 85146722 |
| Molecular Formula | C10H14N5O4PS2 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-[hydroxy(sulfanyl)phosphinothioyl]oxyoxolan-2-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2C1CC(OP(O)(=S)S)C(CO)O1 |
| InChI | InChI=1S/C10H14N5O4PS2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(6(2-16)18-7)19-20(17,21)22/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,21,22) |
| InChIKey | VUXCMGPUYRXSNC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|