C10H15N6O4P — CID 22875104
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyphosphonamidous acid (PubChem CID 22875104) has the molecular formula C10H15N6O4P and a molecular weight of 314.24 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyphosphonamidous acid.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyphosphonamidous acid |
|---|---|
| PubChem CID | 22875104 |
| Molecular Formula | C10H15N6O4P |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyphosphonamidous acid |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](OP(N)O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H15N6O4P/c11-9-8-10(14-3-13-9)16(4-15-8)7-1-5(20-21(12)18)6(2-17)19-7/h3-7,17-18H,1-2,12H2,(H2,11,13,14)/t5-,6+,7+,21?/m0/s1 |
| InChIKey | BOSCAGGSXQUMMT-QWEIFEMGSA-N |
| XLogP | -0.75 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|