C18H18N4O4 — CID 58403785
[(2R,3R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolan-3-yl] benzoate (PubChem CID 58403785) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is [(2R,3R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58403785 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [(2R,3R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolan-3-yl] benzoate |
| SMILES | Cc1ncnc2c1ncn2[C@H]1C[C@@H](OC(=O)c2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C18H18N4O4/c1-11-16-17(20-9-19-11)22(10-21-16)15-7-13(14(8-23)25-15)26-18(24)12-5-3-2-4-6-12/h2-6,9-10,13-15,23H,7-8H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | PVUGKBZFKVPFGC-RBSFLKMASA-N |
| XLogP | 1.64 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |