C24H33N6O5P — CID 66584438
N-[9-[(2R,5R)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 66584438) has the molecular formula C24H33N6O5P and a molecular weight of 516.54 g/mol. Its IUPAC name is N-[9-[(2R,5R)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,5R)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 66584438 |
| Molecular Formula | C24H33N6O5P |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[9-[(2R,5R)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COP(OC1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H33N6O5P/c1-15(2)30(16(3)4)36(33-5)35-18-11-20(34-19(18)12-31)29-14-27-21-22(25-13-26-23(21)29)28-24(32)17-9-7-6-8-10-17/h6-10,13-16,18-20,31H,11-12H2,1-5H3,(H,25,26,28,32)/t18?,19-,20-,36?/m1/s1 |
| InChIKey | ZZWNUSFXXKLYDQ-INVNVVLHSA-N |
| XLogP | 3.74 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|