C19H21N5O4 — CID 90911609
N-[9-[3-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 90911609) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[9-[3-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[3-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 90911609 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[9-[3-methoxy-5-(methoxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COCC1CC(OC)C(n2cnc3c(NC(=O)c4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C19H21N5O4/c1-26-9-13-8-14(27-2)19(28-13)24-11-22-15-16(20-10-21-17(15)24)23-18(25)12-6-4-3-5-7-12/h3-7,10-11,13-14,19H,8-9H2,1-2H3,(H,20,21,23,25) |
| InChIKey | LREBZWFJJREWKI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |