C19H21N5O6P- — CID 140680411
[(2S,5R)-5-(6-benzamidopurin-9-yl)-4-methoxyoxolan-2-yl]methoxy-methylphosphinate (PubChem CID 140680411) has the molecular formula C19H21N5O6P- and a molecular weight of 446.38 g/mol. Its IUPAC name is [(2S,5R)-5-(6-benzamidopurin-9-yl)-4-methoxyoxolan-2-yl]methoxy-methylphosphinate.
| Compound Name | [(2S,5R)-5-(6-benzamidopurin-9-yl)-4-methoxyoxolan-2-yl]methoxy-methylphosphinate |
|---|---|
| PubChem CID | 140680411 |
| Molecular Formula | C19H21N5O6P- |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [(2S,5R)-5-(6-benzamidopurin-9-yl)-4-methoxyoxolan-2-yl]methoxy-methylphosphinate |
| SMILES | COC1C[C@@H](COP(C)(=O)[O-])O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C19H22N5O6P/c1-28-14-8-13(9-29-31(2,26)27)30-19(14)24-11-22-15-16(20-10-21-17(15)24)23-18(25)12-6-4-3-5-7-12/h3-7,10-11,13-14,19H,8-9H2,1-2H3,(H,26,27)(H,20,21,23,25)/p-1/t13-,14?,19+/m0/s1 |
| InChIKey | WIOZIGGUNCXUTI-FCKRREBMSA-M |
| XLogP | 1.58 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|