C19H22N5O6P — CID 159314215
N-[9-[(2R,3S,5R)-5-(dimethylphosphorylmethoxy)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 159314215) has the molecular formula C19H22N5O6P and a molecular weight of 447.39 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-5-(dimethylphosphorylmethoxy)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,5R)-5-(dimethylphosphorylmethoxy)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 159314215 |
| Molecular Formula | C19H22N5O6P |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[9-[(2R,3S,5R)-5-(dimethylphosphorylmethoxy)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CP(C)(=O)CO[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C19H22N5O6P/c1-31(2,28)10-29-19-14(26)13(25)18(30-19)24-9-22-12-15(20-8-21-16(12)24)23-17(27)11-6-4-3-5-7-11/h3-9,13-14,18-19,25-26H,10H2,1-2H3,(H,20,21,23,27)/t13-,14?,18+,19-/m0/s1 |
| InChIKey | UKQFKQVBWGOZKE-FGVBSWQGSA-N |
| XLogP | 1.25 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|