C22H25FN5O7P — CID 91434467
N-[9-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 91434467) has the molecular formula C22H25FN5O7P and a molecular weight of 521.44 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 91434467 |
| Molecular Formula | C22H25FN5O7P |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-(2-diethoxyphosphoryl-2-fluoroethenyl)-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CCOP(=O)(OCC)C(F)=C[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H25FN5O7P/c1-3-33-36(32,34-4-2)15(23)10-14-17(29)18(30)22(35-14)28-12-26-16-19(24-11-25-20(16)28)27-21(31)13-8-6-5-7-9-13/h5-12,14,17-18,22,29-30H,3-4H2,1-2H3,(H,24,25,27,31)/t14-,17-,18-,22-/m1/s1 |
| InChIKey | HQTKSZYZSSOGTB-SAJUPQAESA-N |
| XLogP | 2.77 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|