C21H25N6O7P — CID 74948506
N-[3-[5-(2-diethoxyphosphorylethenyl)-3,4-dihydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide (PubChem CID 74948506) has the molecular formula C21H25N6O7P and a molecular weight of 504.44 g/mol. Its IUPAC name is N-[3-[5-(2-diethoxyphosphorylethenyl)-3,4-dihydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide.
| Compound Name | N-[3-[5-(2-diethoxyphosphorylethenyl)-3,4-dihydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 74948506 |
| Molecular Formula | C21H25N6O7P |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[3-[5-(2-diethoxyphosphorylethenyl)-3,4-dihydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide |
| SMILES | CCOP(=O)(C=CC1OC(n2nnc3c(NC(=O)c4ccccc4)ncnc32)C(O)C1O)OCC |
| InChI | InChI=1S/C21H25N6O7P/c1-3-32-35(31,33-4-2)11-10-14-16(28)17(29)21(34-14)27-19-15(25-26-27)18(22-12-23-19)24-20(30)13-8-6-5-7-9-13/h5-12,14,16-17,21,28-29H,3-4H2,1-2H3,(H,22,23,24,30) |
| InChIKey | IKGRJZWVWIXAAC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 170.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|