C13H21N4O7P — CID 166843169
1-[(3R,4S)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 166843169) has the molecular formula C13H21N4O7P and a molecular weight of 376.31 g/mol. Its IUPAC name is 1-[(3R,4S)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3R,4S)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 166843169 |
| Molecular Formula | C13H21N4O7P |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[(3R,4S)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCOP(=O)(/C=C/C1OC(n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C13H21N4O7P/c1-3-22-25(21,23-4-2)6-5-8-9(18)10(19)13(24-8)17-7-15-12(16-17)11(14)20/h5-10,13,18-19H,3-4H2,1-2H3,(H2,14,20)/b6-5+/t8?,9-,10-,13?/m1/s1 |
| InChIKey | ZJDNHFARGMHBRJ-PBKATJBBSA-N |
| XLogP | -0.22 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|