C9H15N5O6S — CID 162481932
1-[(3R,4S,5R)-3,4-dihydroxy-5-(methanesulfonamidomethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 162481932) has the molecular formula C9H15N5O6S and a molecular weight of 321.32 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3,4-dihydroxy-5-(methanesulfonamidomethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(methanesulfonamidomethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162481932 |
| Molecular Formula | C9H15N5O6S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(methanesulfonamidomethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CS(=O)(=O)NC[C@H]1OC(n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H15N5O6S/c1-21(18,19)12-2-4-5(15)6(16)9(20-4)14-3-11-8(13-14)7(10)17/h3-6,9,12,15-16H,2H2,1H3,(H2,10,17)/t4-,5-,6-,9?/m1/s1 |
| InChIKey | YUFNBXRXTHFUJS-IAHXAJBFSA-N |
| XLogP | -3.45 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |