C12H21N4O7PS — CID 166843181
1-[(2R,3R,4S)-5-(diethoxyphosphorylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 166843181) has the molecular formula C12H21N4O7PS and a molecular weight of 396.36 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-5-(diethoxyphosphorylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2R,3R,4S)-5-(diethoxyphosphorylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 166843181 |
| Molecular Formula | C12H21N4O7PS |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[(2R,3R,4S)-5-(diethoxyphosphorylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCOP(=O)(OCC)SCC1O[C@@H](n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21N4O7PS/c1-3-21-24(20,22-4-2)25-5-7-8(17)9(18)12(23-7)16-6-14-11(15-16)10(13)19/h6-9,12,17-18H,3-5H2,1-2H3,(H2,13,19)/t7?,8-,9-,12-/m1/s1 |
| InChIKey | LFIQFQBOLBWZPY-ZRPURHHZSA-N |
| XLogP | -0.09 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|