C8H12CuN4O5 — CID 174517530
copper;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 174517530) has the molecular formula C8H12CuN4O5 and a molecular weight of 307.75 g/mol. Its IUPAC name is copper;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | copper;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 174517530 |
| Molecular Formula | C8H12CuN4O5 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | copper;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1.[Cu] |
| InChI | InChI=1S/C8H12N4O5.Cu/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8;/h2-5,8,13-15H,1H2,(H2,9,16);/t3-,4-,5-,8-;/m1./s1 |
| InChIKey | QZQMGCADIOCQBL-UHSSARMYSA-N |
| XLogP | -3.01 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |