C8H13N5O4 — CID 46783251
1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide (PubChem CID 46783251) has the molecular formula C8H13N5O4 and a molecular weight of 248.18 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide.
| Compound Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 46783251 |
| Molecular Formula | C8H13N5O4 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncn([13C@@H]2O[13C@H]([13CH2]O)[13CH](O)[13C@@H]2O)n1 |
| InChI | InChI=1S/C8H13N5O4/c9-6(10)7-11-2-13(12-7)8-5(16)4(15)3(1-14)17-8/h2-5,8,14-16H,1H2,(H3,9,10)/t3-,4?,5+,8-/m1/s1/i1+1,3+1,4+1,5+1,8+1 |
| InChIKey | NHKZSTHOYNWEEZ-ZWMFLENSSA-N |
| XLogP | -2.83 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|