C8H11N7O4 — CID 22213612
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-(2H-tetrazol-5-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol (PubChem CID 22213612) has the molecular formula C8H11N7O4 and a molecular weight of 269.22 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-(2H-tetrazol-5-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-(2H-tetrazol-5-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 22213612 |
| Molecular Formula | C8H11N7O4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[3-(2H-tetrazol-5-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc(-c3nn[nH]n3)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H11N7O4/c16-1-3-4(17)5(18)8(19-3)15-2-9-6(12-15)7-10-13-14-11-7/h2-5,8,16-18H,1H2,(H,10,11,13,14)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | FAAVFOISLYIBNM-AFCXAGJDSA-N |
| XLogP | -2.93 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |