C9H12N6O4 — CID 59330625
(2R,4S,5R)-2-(hydroxymethyl)-5-[3-(2H-triazol-4-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol (PubChem CID 59330625) has the molecular formula C9H12N6O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2R,4S,5R)-2-(hydroxymethyl)-5-[3-(2H-triazol-4-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[3-(2H-triazol-4-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 59330625 |
| Molecular Formula | C9H12N6O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[3-(2H-triazol-4-yl)-1,2,4-triazol-1-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc(-c3cn[nH]n3)n2)[C@@H](O)C1O |
| InChI | InChI=1S/C9H12N6O4/c16-2-5-6(17)7(18)9(19-5)15-3-10-8(13-15)4-1-11-14-12-4/h1,3,5-7,9,16-18H,2H2,(H,11,12,14)/t5-,6?,7+,9-/m1/s1 |
| InChIKey | WVKYTWZGOHGGDE-AOXOCZDOSA-N |
| XLogP | -2.33 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |