C12H21N5O4 — CID 46875944
N'-butyl-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide (PubChem CID 46875944) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N'-butyl-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide.
| Compound Name | N'-butyl-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 46875944 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N'-butyl-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide |
| SMILES | CCCC/N=C(\N)c1ncn(C2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C12H21N5O4/c1-2-3-4-14-10(13)11-15-6-17(16-11)12-9(20)8(19)7(5-18)21-12/h6-9,12,18-20H,2-5H2,1H3,(H2,13,14)/t7-,8-,9-,12?/m1/s1 |
| InChIKey | OFTZWLYGPKNBJC-RNRLFLAJSA-N |
| XLogP | -1.61 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|