C15H17N5O6 — CID 23524240
phenyl (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate (PubChem CID 23524240) has the molecular formula C15H17N5O6 and a molecular weight of 363.33 g/mol. Its IUPAC name is phenyl (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate.
| Compound Name | phenyl (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 23524240 |
| Molecular Formula | C15H17N5O6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | phenyl (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate |
| SMILES | N/C(=N/C(=O)Oc1ccccc1)c1ncn(C2OC(CO)C(O)C2O)n1 |
| InChI | InChI=1S/C15H17N5O6/c16-12(18-15(24)25-8-4-2-1-3-5-8)13-17-7-20(19-13)14-11(23)10(22)9(6-21)26-14/h1-5,7,9-11,14,21-23H,6H2,(H2,16,18,24) |
| InChIKey | VPDNICLJSAYKOP-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 165.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|