C11H19N5O5 — CID 58143695
1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-(2-methoxyethyl)-1,2,4-triazole-3-carboximidamide (PubChem CID 58143695) has the molecular formula C11H19N5O5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-(2-methoxyethyl)-1,2,4-triazole-3-carboximidamide.
| Compound Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-(2-methoxyethyl)-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 58143695 |
| Molecular Formula | C11H19N5O5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-(2-methoxyethyl)-1,2,4-triazole-3-carboximidamide |
| SMILES | COCC/N=C(\N)c1ncn([C@@H]2O[C@H](CO)C(O)[C@@H]2O)n1 |
| InChI | InChI=1S/C11H19N5O5/c1-20-3-2-13-9(12)10-14-5-16(15-10)11-8(19)7(18)6(4-17)21-11/h5-8,11,17-19H,2-4H2,1H3,(H2,12,13)/t6-,7?,8+,11-/m1/s1 |
| InChIKey | MWDBKAKLLIZFSC-CSDHVOIESA-N |
| XLogP | -2.76 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|