C18H21N5O8 — CID 72655669
[4-[[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamoyloxymethyl]phenyl] acetate (PubChem CID 72655669) has the molecular formula C18H21N5O8 and a molecular weight of 435.39 g/mol. Its IUPAC name is [4-[[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamoyloxymethyl]phenyl] acetate.
| Compound Name | [4-[[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamoyloxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 72655669 |
| Molecular Formula | C18H21N5O8 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [4-[[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamoyloxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COC(=O)N=C(N)c2ncn(C3OC(CO)C(O)C3O)n2)cc1 |
| InChI | InChI=1S/C18H21N5O8/c1-9(25)30-11-4-2-10(3-5-11)7-29-18(28)21-15(19)16-20-8-23(22-16)17-14(27)13(26)12(6-24)31-17/h2-5,8,12-14,17,24,26-27H,6-7H2,1H3,(H2,19,21,28) |
| InChIKey | WXSOGITUVIRMNV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 191.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|