C16H19N5O7 — CID 23524230
(4-methoxyphenyl) (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate (PubChem CID 23524230) has the molecular formula C16H19N5O7 and a molecular weight of 393.36 g/mol. Its IUPAC name is (4-methoxyphenyl) (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate.
| Compound Name | (4-methoxyphenyl) (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 23524230 |
| Molecular Formula | C16H19N5O7 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (4-methoxyphenyl) (NE)-N-[amino-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazol-3-yl]methylidene]carbamate |
| SMILES | COc1ccc(OC(=O)/N=C(/N)c2ncn(C3OC(CO)C(O)C3O)n2)cc1 |
| InChI | InChI=1S/C16H19N5O7/c1-26-8-2-4-9(5-3-8)27-16(25)19-13(17)14-18-7-21(20-14)15-12(24)11(23)10(6-22)28-15/h2-5,7,10-12,15,22-24H,6H2,1H3,(H2,17,19,25) |
| InChIKey | LRMFPTVDEOKTDA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 174.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|