C16H26N4O7 — CID 174530772
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;ethenyl hexanoate (PubChem CID 174530772) has the molecular formula C16H26N4O7 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;ethenyl hexanoate.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;ethenyl hexanoate |
|---|---|
| PubChem CID | 174530772 |
| Molecular Formula | C16H26N4O7 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;ethenyl hexanoate |
| SMILES | C=COC(=O)CCCCC.NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H12N4O5.C8H14O2/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8;1-3-5-6-7-8(9)10-4-2/h2-5,8,13-15H,1H2,(H2,9,16);4H,2-3,5-7H2,1H3/t3-,4-,5-,8-;/m1./s1 |
| InChIKey | CPOPUKSICBJLMY-UHSSARMYSA-N |
| XLogP | -0.76 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|