C13H14N8O7 — CID 5274283
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;purine-2,6-dione (PubChem CID 5274283) has the molecular formula C13H14N8O7 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;purine-2,6-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;purine-2,6-dione |
|---|---|
| PubChem CID | 5274283 |
| Molecular Formula | C13H14N8O7 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide;purine-2,6-dione |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1.O=C1N=C2N=CN=C2C(=O)N1 |
| InChI | InChI=1S/C8H12N4O5.C5H2N4O2/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8;10-4-2-3(7-1-6-2)8-5(11)9-4/h2-5,8,13-15H,1H2,(H2,9,16);1H,(H,9,10,11)/t3-,4-,5-,8-;/m1./s1 |
| InChIKey | OQAXUKBSORTNAN-UHSSARMYSA-N |
| XLogP | -3.89 |
| TPSA | 226.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |