C9H16N4O5 — CID 158456764
ethane;1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 158456764) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is ethane;1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | ethane;1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 158456764 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | ethane;1-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CC.NC(=O)c1ncn([C@@H]2O[C@H](O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C7H10N4O5.C2H6/c8-4(14)5-9-1-11(10-5)6-2(12)3(13)7(15)16-6;1-2/h1-3,6-7,12-13,15H,(H2,8,14);1-2H3/t2-,3+,6-,7+;/m1./s1 |
| InChIKey | HEQYEJDGIGPUKY-FVAWWXDJSA-N |
| XLogP | -2.03 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |