C8H11Li2N4O8P — CID 57369811
dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 57369811) has the molecular formula C8H11Li2N4O8P and a molecular weight of 336.05 g/mol. Its IUPAC name is dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 57369811 |
| Molecular Formula | C8H11Li2N4O8P |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | NC(=O)c1ncn(C2OC(COP(=O)([O-])[O-])C(O)C2O)n1.[Li+].[Li+] |
| InChI | InChI=1S/C8H13N4O8P.2Li/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18;;/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18);;/q;2*+1/p-2 |
| InChIKey | SIMMZIYZANJRNU-UHFFFAOYSA-L |
| XLogP | -10.15 |
| TPSA | 195.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | -10.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|