C16H19N5O6 — CID 11603260
[(2S,3R,4S,5S)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-2-phenylacetate (PubChem CID 11603260) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-2-phenylacetate.
| Compound Name | [(2S,3R,4S,5S)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 11603260 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(2S,3R,4S,5S)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-2-phenylacetate |
| SMILES | NC(=O)c1ncn([C@H]2O[C@@H](COC(=O)[C@@H](N)c3ccccc3)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C16H19N5O6/c17-10(8-4-2-1-3-5-8)16(25)26-6-9-11(22)12(23)15(27-9)21-7-19-14(20-21)13(18)24/h1-5,7,9-12,15,22-23H,6,17H2,(H2,18,24)/t9-,10-,11-,12-,15-/m0/s1 |
| InChIKey | BBLBSXYFOBZRFK-VSBZFQJLSA-N |
| XLogP | -1.76 |
| TPSA | 175.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |