C14H24N6O7 — CID 10221855
[(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,5R)-2,6-diamino-5-hydroxyhexanoate (PubChem CID 10221855) has the molecular formula C14H24N6O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,5R)-2,6-diamino-5-hydroxyhexanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,5R)-2,6-diamino-5-hydroxyhexanoate |
|---|---|
| PubChem CID | 10221855 |
| Molecular Formula | C14H24N6O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,5R)-2,6-diamino-5-hydroxyhexanoate |
| SMILES | NC[C@H](O)CC[C@H](N)C(=O)OC[C@H]1O[C@@H](n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H24N6O7/c15-3-6(21)1-2-7(16)14(25)26-4-8-9(22)10(23)13(27-8)20-5-18-12(19-20)11(17)24/h5-10,13,21-23H,1-4,15-16H2,(H2,17,24)/t6-,7+,8-,9-,10-,13-/m1/s1 |
| InChIKey | QSLKDIZGFZLVKL-WOFPRYHQSA-N |
| XLogP | -4.03 |
| TPSA | 222.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |