C12H21N4O8P — CID 162481972
[(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl diethyl phosphate (PubChem CID 162481972) has the molecular formula C12H21N4O8P and a molecular weight of 380.29 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl diethyl phosphate.
| Compound Name | [(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 162481972 |
| Molecular Formula | C12H21N4O8P |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@H]1OC(n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21N4O8P/c1-3-21-25(20,22-4-2)23-5-7-8(17)9(18)12(24-7)16-6-14-11(15-16)10(13)19/h6-9,12,17-18H,3-5H2,1-2H3,(H2,13,19)/t7-,8-,9-,12?/m1/s1 |
| InChIKey | MUQAGYJRQUJTRO-RNRLFLAJSA-N |
| XLogP | -0.81 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|