C20H22N5O7P — CID 162481982
1-[(3R,4S,5R)-5-[(diphenoxyphosphorylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 162481982) has the molecular formula C20H22N5O7P and a molecular weight of 475.40 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-5-[(diphenoxyphosphorylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3R,4S,5R)-5-[(diphenoxyphosphorylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162481982 |
| Molecular Formula | C20H22N5O7P |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 1-[(3R,4S,5R)-5-[(diphenoxyphosphorylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(C2O[C@H](CNP(=O)(Oc3ccccc3)Oc3ccccc3)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C20H22N5O7P/c21-18(28)19-22-12-25(24-19)20-17(27)16(26)15(30-20)11-23-33(29,31-13-7-3-1-4-8-13)32-14-9-5-2-6-10-14/h1-10,12,15-17,20,26-27H,11H2,(H2,21,28)(H,23,29)/t15-,16-,17-,20?/m1/s1 |
| InChIKey | WRYNZZLXDYWOBY-GXIXOUGGSA-N |
| XLogP | 0.85 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|